C17H19N3O7P2 — CID 10181663
[[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 10181663) has the molecular formula C17H19N3O7P2 and a molecular weight of 439.30 g/mol. Its IUPAC name is [[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 10181663 |
| Molecular Formula | C17H19N3O7P2 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | COc1cc2ncnc(Nc3ccc(P(=O)(O)CP(=O)(O)O)cc3)c2cc1OC |
| InChI | InChI=1S/C17H19N3O7P2/c1-26-15-7-13-14(8-16(15)27-2)18-9-19-17(13)20-11-3-5-12(6-4-11)28(21,22)10-29(23,24)25/h3-9H,10H2,1-2H3,(H,21,22)(H,18,19,20)(H2,23,24,25) |
| InChIKey | SABHVHBIGLPPIV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 151.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|