C25H26N4O5 — CID 117092365
2-(3-aminophenyl)-6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine (PubChem CID 117092365) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is 2-(3-aminophenyl)-6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine.
| Compound Name | 2-(3-aminophenyl)-6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 117092365 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-(3-aminophenyl)-6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine |
| SMILES | COc1cc2nc(-c3cccc(N)c3)nc(Nc3cc(OC)c(OC)c(OC)c3)c2cc1OC |
| InChI | InChI=1S/C25H26N4O5/c1-30-19-12-17-18(13-20(19)31-2)28-24(14-7-6-8-15(26)9-14)29-25(17)27-16-10-21(32-3)23(34-5)22(11-16)33-4/h6-13H,26H2,1-5H3,(H,27,28,29) |
| InChIKey | IIZQTPRPLKPHGP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|