C27H27N7O4 — CID 66826096
5-[[2-(3-aminophenyl)-6-[2-(dimethylamino)ethoxy]-7-methoxyquinazolin-4-yl]amino]indazole-1-carboxylic acid (PubChem CID 66826096) has the molecular formula C27H27N7O4 and a molecular weight of 513.56 g/mol. Its IUPAC name is 5-[[2-(3-aminophenyl)-6-[2-(dimethylamino)ethoxy]-7-methoxyquinazolin-4-yl]amino]indazole-1-carboxylic acid.
| Compound Name | 5-[[2-(3-aminophenyl)-6-[2-(dimethylamino)ethoxy]-7-methoxyquinazolin-4-yl]amino]indazole-1-carboxylic acid |
|---|---|
| PubChem CID | 66826096 |
| Molecular Formula | C27H27N7O4 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 5-[[2-(3-aminophenyl)-6-[2-(dimethylamino)ethoxy]-7-methoxyquinazolin-4-yl]amino]indazole-1-carboxylic acid |
| SMILES | COc1cc2nc(-c3cccc(N)c3)nc(Nc3ccc4c(cnn4C(=O)O)c3)c2cc1OCCN(C)C |
| InChI | InChI=1S/C27H27N7O4/c1-33(2)9-10-38-24-13-20-21(14-23(24)37-3)31-25(16-5-4-6-18(28)11-16)32-26(20)30-19-7-8-22-17(12-19)15-29-34(22)27(35)36/h4-8,11-15H,9-10,28H2,1-3H3,(H,35,36)(H,30,31,32) |
| InChIKey | CURGPEOEPJRSPC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|