C30H30FN5O4 — CID 141400532
7-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-methoxyquinazolin-6-yl]oxyheptanoic acid (PubChem CID 141400532) has the molecular formula C30H30FN5O4 and a molecular weight of 543.60 g/mol. Its IUPAC name is 7-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-methoxyquinazolin-6-yl]oxyheptanoic acid.
| Compound Name | 7-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-methoxyquinazolin-6-yl]oxyheptanoic acid |
|---|---|
| PubChem CID | 141400532 |
| Molecular Formula | C30H30FN5O4 |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 7-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-methoxyquinazolin-6-yl]oxyheptanoic acid |
| SMILES | COc1cc2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c2cc1OCCCCCCC(=O)O |
| InChI | InChI=1S/C30H30FN5O4/c1-39-27-16-25-24(15-28(27)40-12-5-3-2-4-9-29(37)38)30(33-19-32-25)35-23-10-11-26-21(14-23)17-34-36(26)18-20-7-6-8-22(31)13-20/h6-8,10-11,13-17,19H,2-5,9,12,18H2,1H3,(H,37,38)(H,32,33,35) |
| InChIKey | WBRANYBTZONLPQ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|