C20H16FN5O2 — CID 141400530
4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methoxypyrimidine-5-carbaldehyde (PubChem CID 141400530) has the molecular formula C20H16FN5O2 and a molecular weight of 377.38 g/mol. Its IUPAC name is 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methoxypyrimidine-5-carbaldehyde.
| Compound Name | 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methoxypyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 141400530 |
| Molecular Formula | C20H16FN5O2 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methoxypyrimidine-5-carbaldehyde |
| SMILES | COc1ncnc(Nc2ccc3c(cnn3Cc3cccc(F)c3)c2)c1C=O |
| InChI | InChI=1S/C20H16FN5O2/c1-28-20-17(11-27)19(22-12-23-20)25-16-5-6-18-14(8-16)9-24-26(18)10-13-3-2-4-15(21)7-13/h2-9,11-12H,10H2,1H3,(H,22,23,25) |
| InChIKey | GZMDZUKJDCFTRI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|