C24H22FN5O2 — CID 141400528
ethyl (E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methylpyrimidin-5-yl]prop-2-enoate (PubChem CID 141400528) has the molecular formula C24H22FN5O2 and a molecular weight of 431.47 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methylpyrimidin-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methylpyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 141400528 |
| Molecular Formula | C24H22FN5O2 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | ethyl (E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methylpyrimidin-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(C)ncnc1Nc1ccc2c(cnn2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C24H22FN5O2/c1-3-32-23(31)10-8-21-16(2)26-15-27-24(21)29-20-7-9-22-18(12-20)13-28-30(22)14-17-5-4-6-19(25)11-17/h4-13,15H,3,14H2,1-2H3,(H,26,27,29)/b10-8+ |
| InChIKey | VHLSRFKCDSVFRV-CSKARUKUSA-N |
| XLogP | 4.64 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|