C21H16FN5O2 — CID 141400499
(E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 141400499) has the molecular formula C21H16FN5O2 and a molecular weight of 389.39 g/mol. Its IUPAC name is (E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141400499 |
| Molecular Formula | C21H16FN5O2 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cncnc1Nc1ccc2c(cnn2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C21H16FN5O2/c22-17-3-1-2-14(8-17)12-27-19-6-5-18(9-16(19)11-25-27)26-21-15(4-7-20(28)29)10-23-13-24-21/h1-11,13H,12H2,(H,28,29)(H,23,24,26)/b7-4+ |
| InChIKey | XTDFPHOSENWDAW-QPJJXVBHSA-N |
| XLogP | 3.86 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|