C30H23FN6O2 — CID 71571616
N-[[5-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]furan-2-yl]methyl]prop-2-enamide (PubChem CID 71571616) has the molecular formula C30H23FN6O2 and a molecular weight of 518.55 g/mol. Its IUPAC name is N-[[5-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]furan-2-yl]methyl]prop-2-enamide.
| Compound Name | N-[[5-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]furan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 71571616 |
| Molecular Formula | C30H23FN6O2 |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | N-[[5-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]furan-2-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccc(-c2ccc3ncnc(Nc4ccc5c(cnn5Cc5cccc(F)c5)c4)c3c2)o1 |
| InChI | InChI=1S/C30H23FN6O2/c1-2-29(38)32-16-24-8-11-28(39-24)20-6-9-26-25(14-20)30(34-18-33-26)36-23-7-10-27-21(13-23)15-35-37(27)17-19-4-3-5-22(31)12-19/h2-15,18H,1,16-17H2,(H,32,38)(H,33,34,36) |
| InChIKey | YLDPLWCQQRMIMC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|