C33H31FN6O3 — CID 162228498
(E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]pent-3-en-2-one (PubChem CID 162228498) has the molecular formula C33H31FN6O3 and a molecular weight of 578.65 g/mol. Its IUPAC name is (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 162228498 |
| Molecular Formula | C33H31FN6O3 |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]quinazolin-6-yl]pent-3-en-2-one |
| SMILES | O=C(/C=C/CN1CC2OCCOC2C1)Cc1ccc2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c2c1 |
| InChI | InChI=1S/C33H31FN6O3/c34-25-4-1-3-23(13-25)18-40-30-9-7-26(16-24(30)17-37-40)38-33-28-15-22(6-8-29(28)35-21-36-33)14-27(41)5-2-10-39-19-31-32(20-39)43-12-11-42-31/h1-9,13,15-17,21,31-32H,10-12,14,18-20H2,(H,35,36,38)/b5-2+ |
| InChIKey | ZVBYXVVUYQSODZ-GORDUTHDSA-N |
| XLogP | 4.68 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|