C33H33FN4O4 — CID 158219649
(E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-(4-fluoro-3-methylanilino)-7-[2-(3-oxabicyclo[3.1.0]hexan-6-yl)ethynyl]quinazolin-6-yl]pent-3-en-2-one (PubChem CID 158219649) has the molecular formula C33H33FN4O4 and a molecular weight of 568.65 g/mol. Its IUPAC name is (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-(4-fluoro-3-methylanilino)-7-[2-(3-oxabicyclo[3.1.0]hexan-6-yl)ethynyl]quinazolin-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-(4-fluoro-3-methylanilino)-7-[2-(3-oxabicyclo[3.1.0]hexan-6-yl)ethynyl]quinazolin-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 158219649 |
| Molecular Formula | C33H33FN4O4 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-(4-fluoro-3-methylanilino)-7-[2-(3-oxabicyclo[3.1.0]hexan-6-yl)ethynyl]quinazolin-6-yl]pent-3-en-2-one |
| SMILES | Cc1cc(Nc2ncnc3cc(C#CC4C5COCC45)c(CC(=O)/C=C/CN4CC5OCCOC5C4)cc23)ccc1F |
| InChI | InChI=1S/C33H33FN4O4/c1-20-11-23(5-7-29(20)34)37-33-26-13-22(12-24(39)3-2-8-38-15-31-32(16-38)42-10-9-41-31)21(14-30(26)35-19-36-33)4-6-25-27-17-40-18-28(25)27/h2-3,5,7,11,13-14,19,25,27-28,31-32H,8-10,12,15-18H2,1H3,(H,35,36,37)/b3-2+ |
| InChIKey | FQNYJCYNTQEVLW-NSCUHMNNSA-N |
| XLogP | 3.83 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|