C29H30ClFN4O6S — CID 153257753
(E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-(3-chloro-4-fluoroanilino)-7-(1,1-dioxothiolan-3-yl)oxyquinazolin-6-yl]pent-3-en-2-one (PubChem CID 153257753) has the molecular formula C29H30ClFN4O6S and a molecular weight of 617.10 g/mol. Its IUPAC name is (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-(3-chloro-4-fluoroanilino)-7-(1,1-dioxothiolan-3-yl)oxyquinazolin-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-(3-chloro-4-fluoroanilino)-7-(1,1-dioxothiolan-3-yl)oxyquinazolin-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 153257753 |
| Molecular Formula | C29H30ClFN4O6S |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[4-(3-chloro-4-fluoroanilino)-7-(1,1-dioxothiolan-3-yl)oxyquinazolin-6-yl]pent-3-en-2-one |
| SMILES | O=C(/C=C/CN1CC2OCCOC2C1)Cc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C29H30ClFN4O6S/c30-23-12-19(3-4-24(23)31)34-29-22-11-18(10-20(36)2-1-6-35-14-27-28(15-35)40-8-7-39-27)26(13-25(22)32-17-33-29)41-21-5-9-42(37,38)16-21/h1-4,11-13,17,21,27-28H,5-10,14-16H2,(H,32,33,34)/b2-1+ |
| InChIKey | WUPNOMQLYHWUHQ-OWOJBTEDSA-N |
| XLogP | 3.50 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|