C27H27ClF2N4O4 — CID 161091770
(E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-3-fluoropent-3-en-2-one (PubChem CID 161091770) has the molecular formula C27H27ClF2N4O4 and a molecular weight of 544.99 g/mol. Its IUPAC name is (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-3-fluoropent-3-en-2-one.
| Compound Name | (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-3-fluoropent-3-en-2-one |
|---|---|
| PubChem CID | 161091770 |
| Molecular Formula | C27H27ClF2N4O4 |
| Molecular Weight | 544.99 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-3-fluoropent-3-en-2-one |
| SMILES | CCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1CC(=O)/C(F)=C\CN1C[C@@H]2OCCO[C@@H]2C1 |
| InChI | InChI=1S/C27H27ClF2N4O4/c1-2-36-24-12-22-18(27(32-15-31-22)33-17-3-4-20(29)19(28)11-17)9-16(24)10-23(35)21(30)5-6-34-13-25-26(14-34)38-8-7-37-25/h3-5,9,11-12,15,25-26H,2,6-8,10,13-14H2,1H3,(H,31,32,33)/b21-5+/t25-,26+ |
| InChIKey | NZEJTXLHMPELON-HKVMHJQESA-N |
| XLogP | 4.63 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.99 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|