C25H25ClF2N4O2 — CID 161273586
(E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-3-fluoro-5-piperidin-1-ylpent-3-en-2-one (PubChem CID 161273586) has the molecular formula C25H25ClF2N4O2 and a molecular weight of 486.95 g/mol. Its IUPAC name is (E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-3-fluoro-5-piperidin-1-ylpent-3-en-2-one.
| Compound Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-3-fluoro-5-piperidin-1-ylpent-3-en-2-one |
|---|---|
| PubChem CID | 161273586 |
| Molecular Formula | C25H25ClF2N4O2 |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-3-fluoro-5-piperidin-1-ylpent-3-en-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1CC(=O)/C(F)=C\CN1CCCCC1 |
| InChI | InChI=1S/C25H25ClF2N4O2/c1-34-24-14-22-18(25(30-15-29-22)31-17-5-6-20(27)19(26)13-17)11-16(24)12-23(33)21(28)7-10-32-8-3-2-4-9-32/h5-7,11,13-15H,2-4,8-10,12H2,1H3,(H,29,30,31)/b21-7+ |
| InChIKey | SXWXACYENJUHFF-QPSGOUHRSA-N |
| XLogP | 5.63 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|