C21H19ClFN3O2 — CID 157375772
(E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]hex-3-en-2-one (PubChem CID 157375772) has the molecular formula C21H19ClFN3O2 and a molecular weight of 399.85 g/mol. Its IUPAC name is (E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]hex-3-en-2-one.
| Compound Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]hex-3-en-2-one |
|---|---|
| PubChem CID | 157375772 |
| Molecular Formula | C21H19ClFN3O2 |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]hex-3-en-2-one |
| SMILES | CC/C=C/C(=O)Cc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC |
| InChI | InChI=1S/C21H19ClFN3O2/c1-3-4-5-15(27)8-13-9-16-19(11-20(13)28-2)24-12-25-21(16)26-14-6-7-18(23)17(22)10-14/h4-7,9-12H,3,8H2,1-2H3,(H,24,25,26)/b5-4+ |
| InChIKey | BQIFNLVXXFDDEQ-SNAWJCMRSA-N |
| XLogP | 5.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|