C19H17ClFN5O2 — CID 141288413
4-amino-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]but-2-enamide (PubChem CID 141288413) has the molecular formula C19H17ClFN5O2 and a molecular weight of 401.83 g/mol. Its IUPAC name is 4-amino-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]but-2-enamide.
| Compound Name | 4-amino-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 141288413 |
| Molecular Formula | C19H17ClFN5O2 |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4-amino-N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]but-2-enamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)C=CCN |
| InChI | InChI=1S/C19H17ClFN5O2/c1-28-17-9-15-12(8-16(17)26-18(27)3-2-6-22)19(24-10-23-15)25-11-4-5-14(21)13(20)7-11/h2-5,7-10H,6,22H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | IWMUOTLMURTWJN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|