C26H27ClFN5O2 — CID 123365106
N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(6-methyl-2-azabicyclo[4.1.0]heptan-2-yl)but-2-enamide (PubChem CID 123365106) has the molecular formula C26H27ClFN5O2 and a molecular weight of 495.99 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(6-methyl-2-azabicyclo[4.1.0]heptan-2-yl)but-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(6-methyl-2-azabicyclo[4.1.0]heptan-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 123365106 |
| Molecular Formula | C26H27ClFN5O2 |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(6-methyl-2-azabicyclo[4.1.0]heptan-2-yl)but-2-enamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)C=CCN1CCCC2(C)CC12 |
| InChI | InChI=1S/C26H27ClFN5O2/c1-26-8-4-10-33(23(26)14-26)9-3-5-24(34)32-21-12-17-20(13-22(21)35-2)29-15-30-25(17)31-16-6-7-19(28)18(27)11-16/h3,5-7,11-13,15,23H,4,8-10,14H2,1-2H3,(H,32,34)(H,29,30,31) |
| InChIKey | RQRDTDHKOVOGAZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|