C26H29ClFN5O4 — CID 86764908
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-4-[(2R)-2-(methoxymethyl)azetidin-1-yl]but-2-enamide (PubChem CID 86764908) has the molecular formula C26H29ClFN5O4 and a molecular weight of 530.00 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-4-[(2R)-2-(methoxymethyl)azetidin-1-yl]but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-4-[(2R)-2-(methoxymethyl)azetidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 86764908 |
| Molecular Formula | C26H29ClFN5O4 |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-4-[(2R)-2-(methoxymethyl)azetidin-1-yl]but-2-enamide |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)/C=C/CN1CC[C@@H]1COC |
| InChI | InChI=1S/C26H29ClFN5O4/c1-35-10-11-37-24-14-22-19(26(30-16-29-22)31-17-5-6-21(28)20(27)12-17)13-23(24)32-25(34)4-3-8-33-9-7-18(33)15-36-2/h3-6,12-14,16,18H,7-11,15H2,1-2H3,(H,32,34)(H,29,30,31)/b4-3+/t18-/m1/s1 |
| InChIKey | PCOFCPRYWPQQMW-OAJJDEHYSA-N |
| XLogP | 4.41 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|