C27H29ClFN5O4 — CID 87056632
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-[2-(methoxymethyl)azetidin-1-yl]but-2-enamide (PubChem CID 87056632) has the molecular formula C27H29ClFN5O4 and a molecular weight of 542.01 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-[2-(methoxymethyl)azetidin-1-yl]but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-[2-(methoxymethyl)azetidin-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 87056632 |
| Molecular Formula | C27H29ClFN5O4 |
| Molecular Weight | 542.01 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-[2-(methoxymethyl)azetidin-1-yl]but-2-enamide |
| SMILES | COCC1CCN1C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C27H29ClFN5O4/c1-36-14-18-6-9-34(18)8-2-3-26(35)33-24-12-20-23(13-25(24)38-19-7-10-37-15-19)30-16-31-27(20)32-17-4-5-22(29)21(28)11-17/h2-5,11-13,16,18-19H,6-10,14-15H2,1H3,(H,33,35)(H,30,31,32)/b3-2+/t18?,19-/m0/s1 |
| InChIKey | OVKAWEPHUVGRCJ-SQMXEVSSSA-N |
| XLogP | 4.55 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.01 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|