C36H37ClFN5O9S2 — CID 66547003
benzenesulfonic acid;(E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 66547003) has the molecular formula C36H37ClFN5O9S2 and a molecular weight of 802.30 g/mol. Its IUPAC name is benzenesulfonic acid;(E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | benzenesulfonic acid;(E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 66547003 |
| Molecular Formula | C36H37ClFN5O9S2 |
| Molecular Weight | 802.30 g/mol |
| Exact Mass | 801.17 |
| IUPAC Name | benzenesulfonic acid;(E)-N-[4-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1O[C@H]1CCOC1.O=S(=O)(O)c1ccccc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C24H25ClFN5O3.2C6H6O3S/c1-31(2)8-3-4-23(32)30-21-11-17-20(12-22(21)34-16-7-9-33-13-16)27-14-28-24(17)29-15-5-6-19(26)18(25)10-15;2*7-10(8,9)6-4-2-1-3-5-6/h3-6,10-12,14,16H,7-9,13H2,1-2H3,(H,30,32)(H,27,28,29);2*1-5H,(H,7,8,9)/b4-3+;;/t16-;;/m0../s1 |
| InChIKey | RWCBQAAHGXJOSV-IACUOYJGSA-N |
| XLogP | 6.26 |
| TPSA | 197.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.30 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|