C31H33ClN6O3 — CID 70856591
(E)-N-[4-[3-chloro-4-(2-pyridin-2-ylethyl)anilino]-7-(oxolan-3-yloxy)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 70856591) has the molecular formula C31H33ClN6O3 and a molecular weight of 573.10 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-(2-pyridin-2-ylethyl)anilino]-7-(oxolan-3-yloxy)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-(2-pyridin-2-ylethyl)anilino]-7-(oxolan-3-yloxy)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 70856591 |
| Molecular Formula | C31H33ClN6O3 |
| Molecular Weight | 573.10 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-(2-pyridin-2-ylethyl)anilino]-7-(oxolan-3-yloxy)quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(CCc4ccccn4)c(Cl)c3)ncnc2cc1OC1CCOC1 |
| InChI | InChI=1S/C31H33ClN6O3/c1-38(2)14-5-7-30(39)37-28-17-25-27(18-29(28)41-24-12-15-40-19-24)34-20-35-31(25)36-23-11-9-21(26(32)16-23)8-10-22-6-3-4-13-33-22/h3-7,9,11,13,16-18,20,24H,8,10,12,14-15,19H2,1-2H3,(H,37,39)(H,34,35,36)/b7-5+ |
| InChIKey | UZMMPLQMNAVCRY-FNORWQNLSA-N |
| XLogP | 5.43 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.10 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|