C25H25ClF3N5O3 — CID 141300608
(E)-N-[4-[4-chloro-3-(trifluoromethyl)anilino]-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 141300608) has the molecular formula C25H25ClF3N5O3 and a molecular weight of 535.95 g/mol. Its IUPAC name is (E)-N-[4-[4-chloro-3-(trifluoromethyl)anilino]-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[4-chloro-3-(trifluoromethyl)anilino]-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 141300608 |
| Molecular Formula | C25H25ClF3N5O3 |
| Molecular Weight | 535.95 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | (E)-N-[4-[4-chloro-3-(trifluoromethyl)anilino]-7-[(3R)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(Cl)c(C(F)(F)F)c3)ncnc2cc1O[C@@H]1CCOC1 |
| InChI | InChI=1S/C25H25ClF3N5O3/c1-34(2)8-3-4-23(35)33-21-11-17-20(12-22(21)37-16-7-9-36-13-16)30-14-31-24(17)32-15-5-6-19(26)18(10-15)25(27,28)29/h3-6,10-12,14,16H,7-9,13H2,1-2H3,(H,33,35)(H,30,31,32)/b4-3+/t16-/m1/s1 |
| InChIKey | DSJCPDXJBJZMEJ-QDLOVBKTSA-N |
| XLogP | 5.27 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.95 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|