C31H32FN5O4 — CID 122191935
(E)-4-(dimethylamino)-N-[4-[4-[(3-fluorophenyl)methoxy]anilino]-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]but-2-enamide (PubChem CID 122191935) has the molecular formula C31H32FN5O4 and a molecular weight of 557.63 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[4-[4-[(3-fluorophenyl)methoxy]anilino]-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[4-[4-[(3-fluorophenyl)methoxy]anilino]-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 122191935 |
| Molecular Formula | C31H32FN5O4 |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[4-[4-[(3-fluorophenyl)methoxy]anilino]-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(OCc4cccc(F)c4)cc3)ncnc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C31H32FN5O4/c1-37(2)13-4-7-30(38)36-28-16-26-27(17-29(28)41-25-12-14-39-19-25)33-20-34-31(26)35-23-8-10-24(11-9-23)40-18-21-5-3-6-22(32)15-21/h3-11,15-17,20,25H,12-14,18-19H2,1-2H3,(H,36,38)(H,33,34,35)/b7-4+/t25-/m0/s1 |
| InChIKey | AYNJDFMFFIERLA-OGPASDKVSA-N |
| XLogP | 5.32 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|