C28H28FN5O3 — CID 177208886
(E)-4-(dimethylamino)-N-[7-ethoxy-4-[4-(4-fluorophenoxy)anilino]quinazolin-6-yl]but-2-enamide (PubChem CID 177208886) has the molecular formula C28H28FN5O3 and a molecular weight of 501.56 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[7-ethoxy-4-[4-(4-fluorophenoxy)anilino]quinazolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[7-ethoxy-4-[4-(4-fluorophenoxy)anilino]quinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 177208886 |
| Molecular Formula | C28H28FN5O3 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[7-ethoxy-4-[4-(4-fluorophenoxy)anilino]quinazolin-6-yl]but-2-enamide |
| SMILES | CCOc1cc2ncnc(Nc3ccc(Oc4ccc(F)cc4)cc3)c2cc1NC(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C28H28FN5O3/c1-4-36-26-17-24-23(16-25(26)33-27(35)6-5-15-34(2)3)28(31-18-30-24)32-20-9-13-22(14-10-20)37-21-11-7-19(29)8-12-21/h5-14,16-18H,4,15H2,1-3H3,(H,33,35)(H,30,31,32)/b6-5+ |
| InChIKey | IJFYKFAMDCLBKY-AATRIKPKSA-N |
| XLogP | 5.76 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|