C28H37ClFN5O2 — CID 142934033
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dipropylamino)but-2-enamide;ethane (PubChem CID 142934033) has the molecular formula C28H37ClFN5O2 and a molecular weight of 530.09 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dipropylamino)but-2-enamide;ethane.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dipropylamino)but-2-enamide;ethane |
|---|---|
| PubChem CID | 142934033 |
| Molecular Formula | C28H37ClFN5O2 |
| Molecular Weight | 530.09 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dipropylamino)but-2-enamide;ethane |
| SMILES | CC.CCCN(C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC)CCC |
| InChI | InChI=1S/C26H31ClFN5O2.C2H6/c1-4-11-33(12-5-2)13-7-8-25(34)32-23-15-19-22(16-24(23)35-6-3)29-17-30-26(19)31-18-9-10-21(28)20(27)14-18;1-2/h7-10,14-17H,4-6,11-13H2,1-3H3,(H,32,34)(H,29,30,31);1-2H3/b8-7+; |
| InChIKey | SFJQXBCIIWFLCA-USRGLUTNSA-N |
| XLogP | 7.21 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.09 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|