C28H33ClFN5O4 — CID 10289727
(E)-4-[bis(2-methoxyethyl)amino]-N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]but-2-enamide (PubChem CID 10289727) has the molecular formula C28H33ClFN5O4 and a molecular weight of 558.05 g/mol. Its IUPAC name is (E)-4-[bis(2-methoxyethyl)amino]-N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-[bis(2-methoxyethyl)amino]-N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 10289727 |
| Molecular Formula | C28H33ClFN5O4 |
| Molecular Weight | 558.05 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (E)-4-[bis(2-methoxyethyl)amino]-N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]but-2-enamide |
| SMILES | COCCN(C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC1CC1)CCOC |
| InChI | InChI=1S/C28H33ClFN5O4/c1-37-12-10-35(11-13-38-2)9-3-4-27(36)34-25-15-21-24(16-26(25)39-17-19-5-6-19)31-18-32-28(21)33-20-7-8-23(30)22(29)14-20/h3-4,7-8,14-16,18-19H,5-6,9-13,17H2,1-2H3,(H,34,36)(H,31,32,33)/b4-3+ |
| InChIKey | KULGXJSSBLEZRX-ONEGZZNKSA-N |
| XLogP | 5.04 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.05 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|