C28H29ClFN5O6 — CID 67024529
dimethyl 2-[[4-[[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]propanedioate (PubChem CID 67024529) has the molecular formula C28H29ClFN5O6 and a molecular weight of 586.02 g/mol. Its IUPAC name is dimethyl 2-[[4-[[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]propanedioate.
| Compound Name | dimethyl 2-[[4-[[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]propanedioate |
|---|---|
| PubChem CID | 67024529 |
| Molecular Formula | C28H29ClFN5O6 |
| Molecular Weight | 586.02 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | dimethyl 2-[[4-[[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)N(C)CC=CC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC1CC1 |
| InChI | InChI=1S/C28H29ClFN5O6/c1-35(25(27(37)39-2)28(38)40-3)10-4-5-24(36)34-22-12-18-21(13-23(22)41-14-16-6-7-16)31-15-32-26(18)33-17-8-9-20(30)19(29)11-17/h4-5,8-9,11-13,15-16,25H,6-7,10,14H2,1-3H3,(H,34,36)(H,31,32,33) |
| InChIKey | RQOLADAUYPPAHI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.02 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|