C27H31ClFN5O3 — CID 66936958
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-[[(2S)-oxolan-2-yl]methoxy]quinazolin-6-yl]-4-[methyl(propan-2-yl)amino]but-2-enamide (PubChem CID 66936958) has the molecular formula C27H31ClFN5O3 and a molecular weight of 528.03 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[[(2S)-oxolan-2-yl]methoxy]quinazolin-6-yl]-4-[methyl(propan-2-yl)amino]but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[[(2S)-oxolan-2-yl]methoxy]quinazolin-6-yl]-4-[methyl(propan-2-yl)amino]but-2-enamide |
|---|---|
| PubChem CID | 66936958 |
| Molecular Formula | C27H31ClFN5O3 |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-[[(2S)-oxolan-2-yl]methoxy]quinazolin-6-yl]-4-[methyl(propan-2-yl)amino]but-2-enamide |
| SMILES | CC(C)N(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C27H31ClFN5O3/c1-17(2)34(3)10-4-7-26(35)33-24-13-20-23(14-25(24)37-15-19-6-5-11-36-19)30-16-31-27(20)32-18-8-9-22(29)21(28)12-18/h4,7-9,12-14,16-17,19H,5-6,10-11,15H2,1-3H3,(H,33,35)(H,30,31,32)/b7-4+/t19-/m0/s1 |
| InChIKey | OPGOUSYGJFPHDX-QTWIXLPOSA-N |
| XLogP | 5.56 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|