C28H31ClFN5O3 — CID 68659668
N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[methyl(oxolan-3-ylmethyl)amino]but-2-enamide (PubChem CID 68659668) has the molecular formula C28H31ClFN5O3 and a molecular weight of 540.04 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[methyl(oxolan-3-ylmethyl)amino]but-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[methyl(oxolan-3-ylmethyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 68659668 |
| Molecular Formula | C28H31ClFN5O3 |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[methyl(oxolan-3-ylmethyl)amino]but-2-enamide |
| SMILES | CN(CC=CC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC1CC1)CC1CCOC1 |
| InChI | InChI=1S/C28H31ClFN5O3/c1-35(14-19-8-10-37-15-19)9-2-3-27(36)34-25-12-21-24(13-26(25)38-16-18-4-5-18)31-17-32-28(21)33-20-6-7-23(30)22(29)11-20/h2-3,6-7,11-13,17-19H,4-5,8-10,14-16H2,1H3,(H,34,36)(H,31,32,33) |
| InChIKey | SFLYLOSMCQPLLL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|