C27H31ClFN5O4 — CID 22270192
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[2,2-dimethoxyethyl(methyl)amino]but-2-enamide (PubChem CID 22270192) has the molecular formula C27H31ClFN5O4 and a molecular weight of 544.03 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[2,2-dimethoxyethyl(methyl)amino]but-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[2,2-dimethoxyethyl(methyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 22270192 |
| Molecular Formula | C27H31ClFN5O4 |
| Molecular Weight | 544.03 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[2,2-dimethoxyethyl(methyl)amino]but-2-enamide |
| SMILES | COC(CN(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC1CC1)OC |
| InChI | InChI=1S/C27H31ClFN5O4/c1-34(14-26(36-2)37-3)10-4-5-25(35)33-23-12-19-22(13-24(23)38-15-17-6-7-17)30-16-31-27(19)32-18-8-9-21(29)20(28)11-18/h4-5,8-9,11-13,16-17,26H,6-7,10,14-15H2,1-3H3,(H,33,35)(H,30,31,32)/b5-4+ |
| InChIKey | PFSSTMKRWXPVKJ-SNAWJCMRSA-N |
| XLogP | 5.00 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.03 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|