C27H31ClFN5O3 — CID 57182832
N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[2-methoxypropyl(methyl)amino]but-2-enamide (PubChem CID 57182832) has the molecular formula C27H31ClFN5O3 and a molecular weight of 528.03 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[2-methoxypropyl(methyl)amino]but-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[2-methoxypropyl(methyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 57182832 |
| Molecular Formula | C27H31ClFN5O3 |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[2-methoxypropyl(methyl)amino]but-2-enamide |
| SMILES | COC(C)CN(C)CC=CC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC1CC1 |
| InChI | InChI=1S/C27H31ClFN5O3/c1-17(36-3)14-34(2)10-4-5-26(35)33-24-12-20-23(13-25(24)37-15-18-6-7-18)30-16-31-27(20)32-19-8-9-22(29)21(28)11-19/h4-5,8-9,11-13,16-18H,6-7,10,14-15H2,1-3H3,(H,33,35)(H,30,31,32) |
| InChIKey | QXJXSRHEHYAXFI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|