C29H31ClFN5O5 — CID 86305766
(E)-4-[(4aS,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-N-[4-(3-chloro-4-fluoroanilino)-7-[[(3S)-oxolan-3-yl]methoxy]quinazolin-6-yl]but-2-enamide (PubChem CID 86305766) has the molecular formula C29H31ClFN5O5 and a molecular weight of 584.05 g/mol. Its IUPAC name is (E)-4-[(4aS,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-N-[4-(3-chloro-4-fluoroanilino)-7-[[(3S)-oxolan-3-yl]methoxy]quinazolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-[(4aS,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-N-[4-(3-chloro-4-fluoroanilino)-7-[[(3S)-oxolan-3-yl]methoxy]quinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 86305766 |
| Molecular Formula | C29H31ClFN5O5 |
| Molecular Weight | 584.05 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | (E)-4-[(4aS,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-N-[4-(3-chloro-4-fluoroanilino)-7-[[(3S)-oxolan-3-yl]methoxy]quinazolin-6-yl]but-2-enamide |
| SMILES | O=C(/C=C/CN1C[C@@H]2OCCO[C@H]2C1)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC[C@H]1CCOC1 |
| InChI | InChI=1S/C29H31ClFN5O5/c30-21-10-19(3-4-22(21)31)34-29-20-11-24(25(12-23(20)32-17-33-29)41-16-18-5-7-38-15-18)35-28(37)2-1-6-36-13-26-27(14-36)40-9-8-39-26/h1-4,10-12,17-18,26-27H,5-9,13-16H2,(H,35,37)(H,32,33,34)/b2-1+/t18-,26-,27-/m0/s1 |
| InChIKey | KJQHUWHUFMFWCC-OHPCTPIOSA-N |
| XLogP | 4.18 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.05 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|