C28H35N5O4 — CID 69133751
(E)-N-[4-anilino-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[bis(2-methoxyethyl)amino]but-2-enamide (PubChem CID 69133751) has the molecular formula C28H35N5O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is (E)-N-[4-anilino-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[bis(2-methoxyethyl)amino]but-2-enamide.
| Compound Name | (E)-N-[4-anilino-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[bis(2-methoxyethyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 69133751 |
| Molecular Formula | C28H35N5O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | (E)-N-[4-anilino-7-(cyclopropylmethoxy)quinazolin-6-yl]-4-[bis(2-methoxyethyl)amino]but-2-enamide |
| SMILES | COCCN(C/C=C/C(=O)Nc1cc2c(Nc3ccccc3)ncnc2cc1OCC1CC1)CCOC |
| InChI | InChI=1S/C28H35N5O4/c1-35-15-13-33(14-16-36-2)12-6-9-27(34)32-25-17-23-24(18-26(25)37-19-21-10-11-21)29-20-30-28(23)31-22-7-4-3-5-8-22/h3-9,17-18,20-21H,10-16,19H2,1-2H3,(H,32,34)(H,29,30,31)/b9-6+ |
| InChIKey | FHNOBUJIXOTRQQ-RMKNXTFCSA-N |
| XLogP | 4.25 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|