C30H39N5O4 — CID 66627956
4-[bis(2-methoxyethyl)amino]-N-[7-(cyclopropylmethoxy)-4-(1-phenylethylamino)quinazolin-6-yl]but-2-enamide (PubChem CID 66627956) has the molecular formula C30H39N5O4 and a molecular weight of 533.67 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)amino]-N-[7-(cyclopropylmethoxy)-4-(1-phenylethylamino)quinazolin-6-yl]but-2-enamide.
| Compound Name | 4-[bis(2-methoxyethyl)amino]-N-[7-(cyclopropylmethoxy)-4-(1-phenylethylamino)quinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 66627956 |
| Molecular Formula | C30H39N5O4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | 4-[bis(2-methoxyethyl)amino]-N-[7-(cyclopropylmethoxy)-4-(1-phenylethylamino)quinazolin-6-yl]but-2-enamide |
| SMILES | COCCN(CC=CC(=O)Nc1cc2c(NC(C)c3ccccc3)ncnc2cc1OCC1CC1)CCOC |
| InChI | InChI=1S/C30H39N5O4/c1-22(24-8-5-4-6-9-24)33-30-25-18-27(28(39-20-23-11-12-23)19-26(25)31-21-32-30)34-29(36)10-7-13-35(14-16-37-2)15-17-38-3/h4-10,18-19,21-23H,11-17,20H2,1-3H3,(H,34,36)(H,31,32,33) |
| InChIKey | AZHVHFBKXHCSIL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|