C26H29N5O4 — CID 70040116
(E)-N-[7-methoxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]-4-[(3S)-3-methyl-2-oxomorpholin-4-yl]but-2-enamide (PubChem CID 70040116) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is (E)-N-[7-methoxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]-4-[(3S)-3-methyl-2-oxomorpholin-4-yl]but-2-enamide.
| Compound Name | (E)-N-[7-methoxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]-4-[(3S)-3-methyl-2-oxomorpholin-4-yl]but-2-enamide |
|---|---|
| PubChem CID | 70040116 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (E)-N-[7-methoxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]-4-[(3S)-3-methyl-2-oxomorpholin-4-yl]but-2-enamide |
| SMILES | COc1cc2ncnc(N[C@H](C)c3ccccc3)c2cc1NC(=O)/C=C/CN1CCOC(=O)[C@@H]1C |
| InChI | InChI=1S/C26H29N5O4/c1-17(19-8-5-4-6-9-19)29-25-20-14-22(23(34-3)15-21(20)27-16-28-25)30-24(32)10-7-11-31-12-13-35-26(33)18(31)2/h4-10,14-18H,11-13H2,1-3H3,(H,30,32)(H,27,28,29)/b10-7+/t17-,18+/m1/s1 |
| InChIKey | JAAZCDNQPZKOGW-WGDYAQENSA-N |
| XLogP | 3.55 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|