C33H42N6O4 — CID 54492166
ethyl 2-[4-[4-[[7-cyclopentyloxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]amino]-4-oxobut-2-enyl]piperazin-1-yl]acetate (PubChem CID 54492166) has the molecular formula C33H42N6O4 and a molecular weight of 586.74 g/mol. Its IUPAC name is ethyl 2-[4-[4-[[7-cyclopentyloxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]amino]-4-oxobut-2-enyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[4-[[7-cyclopentyloxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]amino]-4-oxobut-2-enyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 54492166 |
| Molecular Formula | C33H42N6O4 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | ethyl 2-[4-[4-[[7-cyclopentyloxy-4-[[(1R)-1-phenylethyl]amino]quinazolin-6-yl]amino]-4-oxobut-2-enyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CC=CC(=O)Nc2cc3c(N[C@H](C)c4ccccc4)ncnc3cc2OC2CCCC2)CC1 |
| InChI | InChI=1S/C33H42N6O4/c1-3-42-32(41)22-39-18-16-38(17-19-39)15-9-14-31(40)37-29-20-27-28(21-30(29)43-26-12-7-8-13-26)34-23-35-33(27)36-24(2)25-10-5-4-6-11-25/h4-6,9-11,14,20-21,23-24,26H,3,7-8,12-13,15-19,22H2,1-2H3,(H,37,40)(H,34,35,36)/t24-/m1/s1 |
| InChIKey | XWMPORAIHQIJSL-XMMPIXPASA-N |
| XLogP | 4.80 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|