C29H36N6O4 — CID 22270177
ethyl 2-[4-[3-[4-(3-methylanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate (PubChem CID 22270177) has the molecular formula C29H36N6O4 and a molecular weight of 532.65 g/mol. Its IUPAC name is ethyl 2-[4-[3-[4-(3-methylanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[3-[4-(3-methylanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 22270177 |
| Molecular Formula | C29H36N6O4 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | ethyl 2-[4-[3-[4-(3-methylanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate |
| SMILES | C=CC(=O)Nc1cc2c(Nc3cccc(C)c3)ncnc2cc1OCCCN1CCN(CC(=O)OCC)CC1 |
| InChI | InChI=1S/C29H36N6O4/c1-4-27(36)33-25-17-23-24(30-20-31-29(23)32-22-9-6-8-21(3)16-22)18-26(25)39-15-7-10-34-11-13-35(14-12-34)19-28(37)38-5-2/h4,6,8-9,16-18,20H,1,5,7,10-15,19H2,2-3H3,(H,33,36)(H,30,31,32) |
| InChIKey | FMANPQBUVKTDDA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|