C28H33BrN6O4 — CID 11490307
ethyl 2-[4-[3-[4-(3-bromoanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate (PubChem CID 11490307) has the molecular formula C28H33BrN6O4 and a molecular weight of 597.51 g/mol. Its IUPAC name is ethyl 2-[4-[3-[4-(3-bromoanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[3-[4-(3-bromoanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 11490307 |
| Molecular Formula | C28H33BrN6O4 |
| Molecular Weight | 597.51 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | ethyl 2-[4-[3-[4-(3-bromoanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate |
| SMILES | C=CC(=O)Nc1cc2c(Nc3cccc(Br)c3)ncnc2cc1OCCCN1CCN(CC(=O)OCC)CC1 |
| InChI | InChI=1S/C28H33BrN6O4/c1-3-26(36)33-24-16-22-23(30-19-31-28(22)32-21-8-5-7-20(29)15-21)17-25(24)39-14-6-9-34-10-12-35(13-11-34)18-27(37)38-4-2/h3,5,7-8,15-17,19H,1,4,6,9-14,18H2,2H3,(H,33,36)(H,30,31,32) |
| InChIKey | KTRMJZKBFCFXLV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|