C27H35BrN6O3 — CID 22269897
ethyl 4-[4-[3-[6-amino-4-(3-bromoanilino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]butanoate (PubChem CID 22269897) has the molecular formula C27H35BrN6O3 and a molecular weight of 571.52 g/mol. Its IUPAC name is ethyl 4-[4-[3-[6-amino-4-(3-bromoanilino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-[3-[6-amino-4-(3-bromoanilino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 22269897 |
| Molecular Formula | C27H35BrN6O3 |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | ethyl 4-[4-[3-[6-amino-4-(3-bromoanilino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCN1CCN(CCCOc2cc3ncnc(Nc4cccc(Br)c4)c3cc2N)CC1 |
| InChI | InChI=1S/C27H35BrN6O3/c1-2-36-26(35)8-4-9-33-11-13-34(14-12-33)10-5-15-37-25-18-24-22(17-23(25)29)27(31-19-30-24)32-21-7-3-6-20(28)16-21/h3,6-7,16-19H,2,4-5,8-15,29H2,1H3,(H,30,31,32) |
| InChIKey | XNFZMDQJJVGHFD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|