C26H34BrN6O6P — CID 22270174
N-(3-bromophenyl)-7-[3-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]propoxy]-6-nitroquinazolin-4-amine (PubChem CID 22270174) has the molecular formula C26H34BrN6O6P and a molecular weight of 637.47 g/mol. Its IUPAC name is N-(3-bromophenyl)-7-[3-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]propoxy]-6-nitroquinazolin-4-amine.
| Compound Name | N-(3-bromophenyl)-7-[3-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]propoxy]-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 22270174 |
| Molecular Formula | C26H34BrN6O6P |
| Molecular Weight | 637.47 g/mol |
| Exact Mass | 636.15 |
| IUPAC Name | N-(3-bromophenyl)-7-[3-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]propoxy]-6-nitroquinazolin-4-amine |
| SMILES | CCOP(=O)(CN1CCN(CCCOc2cc3ncnc(Nc4cccc(Br)c4)c3cc2[N+](=O)[O-])CC1)OCC |
| InChI | InChI=1S/C26H34BrN6O6P/c1-3-38-40(36,39-4-2)19-32-12-10-31(11-13-32)9-6-14-37-25-17-23-22(16-24(25)33(34)35)26(29-18-28-23)30-21-8-5-7-20(27)15-21/h5,7-8,15-18H,3-4,6,9-14,19H2,1-2H3,(H,28,29,30) |
| InChIKey | SZJMLLRXPOZOOP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|