C19H19BrN4O6S — CID 57217161
1-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxybutyl methanesulfonate (PubChem CID 57217161) has the molecular formula C19H19BrN4O6S and a molecular weight of 511.35 g/mol. Its IUPAC name is 1-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxybutyl methanesulfonate.
| Compound Name | 1-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxybutyl methanesulfonate |
|---|---|
| PubChem CID | 57217161 |
| Molecular Formula | C19H19BrN4O6S |
| Molecular Weight | 511.35 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | 1-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxybutyl methanesulfonate |
| SMILES | CCCC(Oc1cc2ncnc(Nc3cccc(Br)c3)c2cc1[N+](=O)[O-])OS(C)(=O)=O |
| InChI | InChI=1S/C19H19BrN4O6S/c1-3-5-18(30-31(2,27)28)29-17-10-15-14(9-16(17)24(25)26)19(22-11-21-15)23-13-7-4-6-12(20)8-13/h4,6-11,18H,3,5H2,1-2H3,(H,21,22,23) |
| InChIKey | FLHMNENYLZGEPZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|