C19H18BrN5O3 — CID 22270194
N-(3-bromophenyl)-6-nitro-7-piperidin-4-yloxyquinazolin-4-amine (PubChem CID 22270194) has the molecular formula C19H18BrN5O3 and a molecular weight of 444.29 g/mol. Its IUPAC name is N-(3-bromophenyl)-6-nitro-7-piperidin-4-yloxyquinazolin-4-amine.
| Compound Name | N-(3-bromophenyl)-6-nitro-7-piperidin-4-yloxyquinazolin-4-amine |
|---|---|
| PubChem CID | 22270194 |
| Molecular Formula | C19H18BrN5O3 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-(3-bromophenyl)-6-nitro-7-piperidin-4-yloxyquinazolin-4-amine |
| SMILES | O=[N+]([O-])c1cc2c(Nc3cccc(Br)c3)ncnc2cc1OC1CCNCC1 |
| InChI | InChI=1S/C19H18BrN5O3/c20-12-2-1-3-13(8-12)24-19-15-9-17(25(26)27)18(10-16(15)22-11-23-19)28-14-4-6-21-7-5-14/h1-3,8-11,14,21H,4-7H2,(H,22,23,24) |
| InChIKey | IICWZQMYAIBAHZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|