C18H14ClFN4O4 — CID 163197476
N-(3-chloro-2-fluorophenyl)-6-nitro-7-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine (PubChem CID 163197476) has the molecular formula C18H14ClFN4O4 and a molecular weight of 404.79 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-6-nitro-7-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine.
| Compound Name | N-(3-chloro-2-fluorophenyl)-6-nitro-7-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine |
|---|---|
| PubChem CID | 163197476 |
| Molecular Formula | C18H14ClFN4O4 |
| Molecular Weight | 404.79 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-6-nitro-7-[(3S)-oxolan-3-yl]oxyquinazolin-4-amine |
| SMILES | O=[N+]([O-])c1cc2c(Nc3cccc(Cl)c3F)ncnc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C18H14ClFN4O4/c19-12-2-1-3-13(17(12)20)23-18-11-6-15(24(25)26)16(7-14(11)21-9-22-18)28-10-4-5-27-8-10/h1-3,6-7,9-10H,4-5,8H2,(H,21,22,23)/t10-/m0/s1 |
| InChIKey | KNDKOSOZDFPVKF-JTQLQIEISA-N |
| XLogP | 4.24 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|