C20H17ClFN3O4 — CID 70801633
7-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-4-(3-chloro-2-fluoroanilino)quinazolin-6-ol (PubChem CID 70801633) has the molecular formula C20H17ClFN3O4 and a molecular weight of 417.82 g/mol. Its IUPAC name is 7-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-4-(3-chloro-2-fluoroanilino)quinazolin-6-ol.
| Compound Name | 7-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-4-(3-chloro-2-fluoroanilino)quinazolin-6-ol |
|---|---|
| PubChem CID | 70801633 |
| Molecular Formula | C20H17ClFN3O4 |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 7-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-4-(3-chloro-2-fluoroanilino)quinazolin-6-ol |
| SMILES | Oc1cc2c(Nc3cccc(Cl)c3F)ncnc2cc1OC1COC2CCOC21 |
| InChI | InChI=1S/C20H17ClFN3O4/c21-11-2-1-3-12(18(11)22)25-20-10-6-14(26)16(7-13(10)23-9-24-20)29-17-8-28-15-4-5-27-19(15)17/h1-3,6-7,9,15,17,19,26H,4-5,8H2,(H,23,24,25) |
| InChIKey | UXMCLOVFGLJGSJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |