C21H22ClFN4O2 — CID 25017541
6-(4-aminocyclohexyl)oxy-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine (PubChem CID 25017541) has the molecular formula C21H22ClFN4O2 and a molecular weight of 416.88 g/mol. Its IUPAC name is 6-(4-aminocyclohexyl)oxy-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-(4-aminocyclohexyl)oxy-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 25017541 |
| Molecular Formula | C21H22ClFN4O2 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 6-(4-aminocyclohexyl)oxy-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1OC1CCC(N)CC1 |
| InChI | InChI=1S/C21H22ClFN4O2/c1-28-18-10-17-14(9-19(18)29-13-7-5-12(24)6-8-13)21(26-11-25-17)27-16-4-2-3-15(22)20(16)23/h2-4,9-13H,5-8,24H2,1H3,(H,25,26,27) |
| InChIKey | JOQWSMYNXPBHBB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |