C26H31ClFN5O4 — CID 123547271
(2S)-2-[4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-2-[2-(methylamino)ethylamino]acetic acid (PubChem CID 123547271) has the molecular formula C26H31ClFN5O4 and a molecular weight of 532.02 g/mol. Its IUPAC name is (2S)-2-[4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-2-[2-(methylamino)ethylamino]acetic acid.
| Compound Name | (2S)-2-[4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-2-[2-(methylamino)ethylamino]acetic acid |
|---|---|
| PubChem CID | 123547271 |
| Molecular Formula | C26H31ClFN5O4 |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | (2S)-2-[4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclohexyl]-2-[2-(methylamino)ethylamino]acetic acid |
| SMILES | CNCCN[C@H](C(=O)O)C1CCC(Oc2cc3c(Nc4cccc(Cl)c4F)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C26H31ClFN5O4/c1-29-10-11-30-24(26(34)35)15-6-8-16(9-7-15)37-22-12-17-20(13-21(22)36-2)31-14-32-25(17)33-19-5-3-4-18(27)23(19)28/h3-5,12-16,24,29-30H,6-11H2,1-2H3,(H,34,35)(H,31,32,33)/t15?,16?,24-/m0/s1 |
| InChIKey | NBTXLTCIMFRUNF-WLNDFMDLSA-N |
| XLogP | 4.37 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|