C15H9ClFN3O2 — CID 138513770
N-(3-chloro-2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine (PubChem CID 138513770) has the molecular formula C15H9ClFN3O2 and a molecular weight of 317.71 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine.
| Compound Name | N-(3-chloro-2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine |
|---|---|
| PubChem CID | 138513770 |
| Molecular Formula | C15H9ClFN3O2 |
| Molecular Weight | 317.71 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine |
| SMILES | Fc1c(Cl)cccc1Nc1ncnc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C15H9ClFN3O2/c16-9-2-1-3-10(14(9)17)20-15-8-4-12-13(22-7-21-12)5-11(8)18-6-19-15/h1-6H,7H2,(H,18,19,20) |
| InChIKey | DMHGPRJZXFRVSF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |