C17H12ClN3O2 — CID 18925061
N-(3-ethynylphenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine;hydrochloride (PubChem CID 18925061) has the molecular formula C17H12ClN3O2 and a molecular weight of 325.76 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine;hydrochloride.
| Compound Name | N-(3-ethynylphenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine;hydrochloride |
|---|---|
| PubChem CID | 18925061 |
| Molecular Formula | C17H12ClN3O2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-(3-ethynylphenyl)-[1,3]dioxolo[4,5-g]quinazolin-8-amine;hydrochloride |
| SMILES | C#Cc1cccc(Nc2ncnc3cc4c(cc23)OCO4)c1.Cl |
| InChI | InChI=1S/C17H11N3O2.ClH/c1-2-11-4-3-5-12(6-11)20-17-13-7-15-16(22-10-21-15)8-14(13)18-9-19-17;/h1,3-9H,10H2,(H,18,19,20);1H |
| InChIKey | WMJUQSKPKWEBOC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|