C19H18ClN3S — CID 18925082
N-(3-ethynylphenyl)-7-propylsulfanylquinazolin-4-amine;hydrochloride (PubChem CID 18925082) has the molecular formula C19H18ClN3S and a molecular weight of 355.89 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-7-propylsulfanylquinazolin-4-amine;hydrochloride.
| Compound Name | N-(3-ethynylphenyl)-7-propylsulfanylquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 18925082 |
| Molecular Formula | C19H18ClN3S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-(3-ethynylphenyl)-7-propylsulfanylquinazolin-4-amine;hydrochloride |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(SCCC)ccc23)c1.Cl |
| InChI | InChI=1S/C19H17N3S.ClH/c1-3-10-23-16-8-9-17-18(12-16)20-13-21-19(17)22-15-7-5-6-14(4-2)11-15;/h2,5-9,11-13H,3,10H2,1H3,(H,20,21,22);1H |
| InChIKey | MANKXCCTWMBZAA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|