About N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid
N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid (PubChem CID 175292977) has the molecular formula C19H17N3O4
and a molecular weight of 351.36 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid.
Molecular Properties
| Compound Name | N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid |
| PubChem CID | 175292977 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)ccc23)c1.O=C(O)CO |
| InChI | InChI=1S/C17H13N3O.C2H4O3/c1-3-12-5-4-6-13(9-12)20-17-15-8-7-14(21-2)10-16(15)18-11-19-17;3-1-2(4)5/h1,4-11H,2H3,(H,18,19,20);3H,1H2,(H,4,5) |
| InChIKey | FLPAUEHWILQDPQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid?
The IUPAC name of N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid (CID 175292977) is N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid.
What is the SMILES notation for N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid?
The canonical SMILES for N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid is C#Cc1cccc(Nc2ncnc3cc(OC)ccc23)c1.O=C(O)CO.
What is the InChIKey of N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid?
The InChIKey is FLPAUEHWILQDPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O.C2H4O3/c1-3-12-5-4-6-13(9-12)20-17-15-8-7-14(21-2)10-16(15)18-11-19-17;3-1-2(4)5/h1,4-11H,2H3,(H,18,19,20);3H,1H2,(H,4,5).
What are the key properties of N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid?
N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid has a molecular weight of 351.36 g/mol, XLogP of 2.43, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethynylphenyl)-7-methoxyquinazolin-4-amine;2-hydroxyacetic acid is sourced from PubChem (CID 175292977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).