C16H12N4 — CID 22460851
N-(3-ethynylphenyl)-6-methylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 22460851) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6-methylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-(3-ethynylphenyl)-6-methylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22460851 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(3-ethynylphenyl)-6-methylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cnc(C)cc23)c1 |
| InChI | InChI=1S/C16H12N4/c1-3-12-5-4-6-13(8-12)20-16-14-7-11(2)17-9-15(14)18-10-19-16/h1,4-10H,2H3,(H,18,19,20) |
| InChIKey | DQPZEBGUKFCFCP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|